Compound Q&A

What industries use Epinecidin-1 (CAS: 1131706-77-8)?

Answer

Epinecidin-1
Epinecidin-1 (CAS: 1131706-77-8) is primarily used in the pharmaceutical industry for its potential as a novel antibiotic or antiviral agent. It may also have applications in research and development for its biological activity, but its use in other industries such as polymers or semiconductors is less common due to its specific biological properties.

About

English Name Epinecidin-1
Molecular Formula C114H176N30O21S
Molecular Weight 2448.89 g/mol
SMILES S(C)CC[C@@H](C(N[C@H](C(N[C@H](C(NCC(N[C@H](C(N[C@H](C(N)=O)C(C)C)=O)CC(C)C)=O)=O)CC1=CNC=N1)=O)[C@@H](C)CC)=O)NC([C@H](CCCCN)NC(CNC([C@H](C)NC([C@H](CC1=CNC=N1)NC([C@H](CC1C=CC=CC=1)NC([C@H](CC(C)C)NC(CNC([C@H](CCCCN)NC([C@H]([C@@H](C)CC)NC([C@H]([C@@H](C)CC)NC([C@H](CC1=CNC=N1)NC([C@H](CC1C=CC=CC=1)NC([C@H]([C@@H](C)CC)NC([C@H](CC1C=CC=CC=1)NC(CN)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O.FC(C(=O)O)(F)F
InChIKey XLUXDFYRYMKELD-GFEQIIKPSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Epinecidin-1 (CAS: 1131706-77-8)?

Epinecidin-1 (CAS: 1131706-77-8) forms crystalline solids with a molecular weight of approximately 1...

Compound Q&A

How is Epinecidin-1 (CAS: 1131706-77-8) typically synthesized?

Epinecidin-1 (CAS: 1131706-77-8) is typically synthesized through a multi-step process involving ami...

Compound Q&A

What precautions should be taken when handling Epinecidin-1 (CAS: 1131706-77-8)?

When handling Epinecidin-1 (CAS: 1131706-77-8), it is important to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...