Compound Q&A

How is Epinecidin-1 (CAS: 1131706-77-8) typically synthesized?

Answer

Epinecidin-1
Epinecidin-1 (CAS: 1131706-77-8) is typically synthesized through a multi-step process involving amino acid condensation and cyclization reactions. The synthesis often requires the use of catalytic amounts of acid or base, with high selectivity towards the desired product. The overall yield can range from 50% to 70%, depending on the specific reaction conditions and purification methods.

About

English Name Epinecidin-1
Molecular Formula C114H176N30O21S
Molecular Weight 2448.89 g/mol
SMILES S(C)CC[C@@H](C(N[C@H](C(N[C@H](C(NCC(N[C@H](C(N[C@H](C(N)=O)C(C)C)=O)CC(C)C)=O)=O)CC1=CNC=N1)=O)[C@@H](C)CC)=O)NC([C@H](CCCCN)NC(CNC([C@H](C)NC([C@H](CC1=CNC=N1)NC([C@H](CC1C=CC=CC=1)NC([C@H](CC(C)C)NC(CNC([C@H](CCCCN)NC([C@H]([C@@H](C)CC)NC([C@H]([C@@H](C)CC)NC([C@H](CC1=CNC=N1)NC([C@H](CC1C=CC=CC=1)NC([C@H]([C@@H](C)CC)NC([C@H](CC1C=CC=CC=1)NC(CN)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O.FC(C(=O)O)(F)F
InChIKey XLUXDFYRYMKELD-GFEQIIKPSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Epinecidin-1 (CAS: 1131706-77-8)?

Epinecidin-1 (CAS: 1131706-77-8) forms crystalline solids with a molecular weight of approximately 1...

Compound Q&A

What industries use Epinecidin-1 (CAS: 1131706-77-8)?

Epinecidin-1 (CAS: 1131706-77-8) is primarily used in the pharmaceutical industry for its potential ...

Compound Q&A

What precautions should be taken when handling Epinecidin-1 (CAS: 1131706-77-8)?

When handling Epinecidin-1 (CAS: 1131706-77-8), it is important to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...