Compound Q&A

What are the physical and chemical properties of Epinecidin-1 (CAS: 1131706-77-8)?

Answer

Epinecidin-1
Epinecidin-1 (CAS: 1131706-77-8) forms crystalline solids with a molecular weight of approximately 1,013 Da. It has limited water solubility, making it less soluble in common organic solvents. Epinecidin-1 is stable under mild conditions but can be reactive under extreme pH or temperature variations. It exhibits good stability in the presence of common organic solvents and has low reactivity with common metal ions.

About

English Name Epinecidin-1
Molecular Formula C114H176N30O21S
Molecular Weight 2448.89 g/mol
SMILES S(C)CC[C@@H](C(N[C@H](C(N[C@H](C(NCC(N[C@H](C(N[C@H](C(N)=O)C(C)C)=O)CC(C)C)=O)=O)CC1=CNC=N1)=O)[C@@H](C)CC)=O)NC([C@H](CCCCN)NC(CNC([C@H](C)NC([C@H](CC1=CNC=N1)NC([C@H](CC1C=CC=CC=1)NC([C@H](CC(C)C)NC(CNC([C@H](CCCCN)NC([C@H]([C@@H](C)CC)NC([C@H]([C@@H](C)CC)NC([C@H](CC1=CNC=N1)NC([C@H](CC1C=CC=CC=1)NC([C@H]([C@@H](C)CC)NC([C@H](CC1C=CC=CC=1)NC(CN)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O.FC(C(=O)O)(F)F
InChIKey XLUXDFYRYMKELD-GFEQIIKPSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

How is Epinecidin-1 (CAS: 1131706-77-8) typically synthesized?

Epinecidin-1 (CAS: 1131706-77-8) is typically synthesized through a multi-step process involving ami...

Compound Q&A

What industries use Epinecidin-1 (CAS: 1131706-77-8)?

Epinecidin-1 (CAS: 1131706-77-8) is primarily used in the pharmaceutical industry for its potential ...

Compound Q&A

What precautions should be taken when handling Epinecidin-1 (CAS: 1131706-77-8)?

When handling Epinecidin-1 (CAS: 1131706-77-8), it is important to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...