Compound Q&A

What precautions should be taken when handling Methyl 4-bromoisoquinoline-1-carboxylate (CAS: 1512077-05-2)?

Answer

Methyl 4-bromoisoquinoline-1-carboxylate
When handling Methyl 4-bromoisoquinoline-1-carboxylate (CAS: 1512077-05-2), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be stored in a cool, dry place away from direct sunlight. Fume hoods should be used during handling to minimize exposure to bromine fumes. In case of a spill, neutralize the spill with an appropriate neutralizing agent and dispose of it according to local regulations. Refer to the SDS for detailed safety information.

About

English Name Methyl 4-bromoisoquinoline-1-carboxylate
Molecular Formula C11H8BrNO2
Molecular Weight 266.09 g/mol
SMILES COC(=O)c1ncc(c2c1cccc2)Br
InChIKey KNFXYFNXGJHAEI-UHFFFAOYSA-N
Last Updated: 2026-03-08 04:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-bromoisoquinoline-1-carboxylate (CAS: 1512077-05-2)?

Methyl 4-bromoisoquinoline-1-carboxylate (CAS: 1512077-05-2) is a crystalline compound with a molecu...

Compound Q&A

How is Methyl 4-bromoisoquinoline-1-carboxylate (CAS: 1512077-05-2) typically synthesized?

Methyl 4-bromoisoquinoline-1-carboxylate (CAS: 1512077-05-2) is typically synthesized through a brom...

Compound Q&A

What industries use Methyl 4-bromoisoquinoline-1-carboxylate (CAS: 1512077-05-2)?

Methyl 4-bromoisoquinoline-1-carboxylate (CAS: 1512077-05-2) is used in the pharmaceutical industry ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...