Compound Q&A

What industries use Methyl 4-bromoisoquinoline-1-carboxylate (CAS: 1512077-05-2)?

Answer

Methyl 4-bromoisoquinoline-1-carboxylate
Methyl 4-bromoisoquinoline-1-carboxylate (CAS: 1512077-05-2) is used in the pharmaceutical industry for the synthesis of certain drug intermediates. It is also utilized in the semiconductor industry for the production of specific organic compounds used in electronic applications and as a precursor in the manufacturing of polymers with unique properties.

About

English Name Methyl 4-bromoisoquinoline-1-carboxylate
Molecular Formula C11H8BrNO2
Molecular Weight 266.09 g/mol
SMILES COC(=O)c1ncc(c2c1cccc2)Br
InChIKey KNFXYFNXGJHAEI-UHFFFAOYSA-N
Last Updated: 2026-03-08 04:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-bromoisoquinoline-1-carboxylate (CAS: 1512077-05-2)?

Methyl 4-bromoisoquinoline-1-carboxylate (CAS: 1512077-05-2) is a crystalline compound with a molecu...

Compound Q&A

How is Methyl 4-bromoisoquinoline-1-carboxylate (CAS: 1512077-05-2) typically synthesized?

Methyl 4-bromoisoquinoline-1-carboxylate (CAS: 1512077-05-2) is typically synthesized through a brom...

Compound Q&A

What precautions should be taken when handling Methyl 4-bromoisoquinoline-1-carboxylate (CAS: 1512077-05-2)?

When handling Methyl 4-bromoisoquinoline-1-carboxylate (CAS: 1512077-05-2), it is essential to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...