Compound Q&A

What industries use 5-Fluoro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 707541-47-7)?

Answer

5-Fluoro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one
5-Fluoro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 707541-47-7) is used in the pharmaceutical industry as an intermediate in the synthesis of various drugs due to its unique chemical structure. It also finds applications in the production of certain polymers and as a precursor in the development of chemical sensors and semiconductors.

About

English Name 5-Fluoro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one
Molecular Formula C12H12FNO2
Molecular Weight 221.23 g/mol
SMILES Fc1ccc2c(c1)C(=O)OC12CCNCC1
InChIKey ARKQQEOEWIQJBC-UHFFFAOYSA-N
Last Updated: 2026-03-08 04:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Fluoro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 707541-47-7)?

5-Fluoro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 707541-47-7) is a crystalline solid with ...

Compound Q&A

How is 5-Fluoro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 707541-47-7) typically synthesized?

5-Fluoro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one can be synthesized via the reaction of 2-benzof...

Compound Q&A

What precautions should be taken when handling 5-Fluoro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 707541-47-7)?

When handling 5-Fluoro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 707541-47-7), it is importa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...