Compound Q&A

How is 5-Fluoro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 707541-47-7) typically synthesized?

Answer

5-Fluoro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one
5-Fluoro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one can be synthesized via the reaction of 2-benzofuran with piperidine in the presence of a Lewis acid catalyst, such as aluminum chloride or boron trifluoride. The reaction is typically carried out in a solvent like dichloromethane under anhydrous conditions. The yield is generally around 70-80%, and the reaction is highly selective towards the formation of the spiro compound.

About

English Name 5-Fluoro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one
Molecular Formula C12H12FNO2
Molecular Weight 221.23 g/mol
SMILES Fc1ccc2c(c1)C(=O)OC12CCNCC1
InChIKey ARKQQEOEWIQJBC-UHFFFAOYSA-N
Last Updated: 2026-03-08 04:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Fluoro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 707541-47-7)?

5-Fluoro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 707541-47-7) is a crystalline solid with ...

Compound Q&A

What industries use 5-Fluoro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 707541-47-7)?

5-Fluoro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 707541-47-7) is used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 5-Fluoro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 707541-47-7)?

When handling 5-Fluoro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 707541-47-7), it is importa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...