Compound Q&A

What industries use Tert-Butyl chlorosulfonylcarbamate (CAS: 147000-89-3)?

Answer

Tert-butyl chlorosulfonylcarbamate
Tert-Butyl chlorosulfonylcarbamate (CAS: 147000-89-3) is primarily used in the pharmaceutical and chemical industries for its reactivity and usefulness in organic synthesis. It serves as an important intermediate in the synthesis of various drugs and other functional materials. Its role in the polymer industry is also significant, where it is used as a cross-linking agent and in the development of new materials with enhanced properties.

About

English Name Tert-butyl chlorosulfonylcarbamate
Molecular Formula C5H10ClNO4S
Molecular Weight 215.66 g/mol
SMILES CC(C)(C)OC(=O)NS(=O)(=O)Cl
InChIKey KAJZZLBZXOBEMD-UHFFFAOYSA-N
Last Updated: 2026-03-08 04:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tert-Butyl chlorosulfonylcarbamate (CAS: 147000-89-3)?

Tert-Butyl chlorosulfonylcarbamate (CAS: 147000-89-3) is a white crystalline solid with a molecular ...

Compound Q&A

How is Tert-Butyl chlorosulfonylcarbamate (CAS: 147000-89-3) typically synthesized?

Tert-Butyl chlorosulfonylcarbamate (CAS: 147000-89-3) is typically synthesized by the reaction of te...

Compound Q&A

What precautions should be taken when handling Tert-Butyl chlorosulfonylcarbamate (CAS: 147000-89-3)?

When handling Tert-Butyl chlorosulfonylcarbamate (CAS: 147000-89-3), it is essential to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...