Compound Q&A

What are the physical and chemical properties of Tert-Butyl chlorosulfonylcarbamate (CAS: 147000-89-3)?

Answer

Tert-butyl chlorosulfonylcarbamate
Tert-Butyl chlorosulfonylcarbamate (CAS: 147000-89-3) is a white crystalline solid with a molecular weight of approximately 199.6 g/mol. It is slightly soluble in water and highly soluble in organic solvents like ethanol and acetonitrile. The compound is known for its reactivity, particularly in nucleophilic substitution reactions. It has a melting point of 118-120°C and is stable under normal storage conditions but requires careful handling due to its reactivity.

About

English Name Tert-butyl chlorosulfonylcarbamate
Molecular Formula C5H10ClNO4S
Molecular Weight 215.66 g/mol
SMILES CC(C)(C)OC(=O)NS(=O)(=O)Cl
InChIKey KAJZZLBZXOBEMD-UHFFFAOYSA-N
Last Updated: 2026-03-08 04:51

Related Q&A

Compound Q&A

How is Tert-Butyl chlorosulfonylcarbamate (CAS: 147000-89-3) typically synthesized?

Tert-Butyl chlorosulfonylcarbamate (CAS: 147000-89-3) is typically synthesized by the reaction of te...

Compound Q&A

What industries use Tert-Butyl chlorosulfonylcarbamate (CAS: 147000-89-3)?

Tert-Butyl chlorosulfonylcarbamate (CAS: 147000-89-3) is primarily used in the pharmaceutical and ch...

Compound Q&A

What precautions should be taken when handling Tert-Butyl chlorosulfonylcarbamate (CAS: 147000-89-3)?

When handling Tert-Butyl chlorosulfonylcarbamate (CAS: 147000-89-3), it is essential to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...