Compound Q&A

What industries use (2S)-3-(Benzyloxy)-2-hydroxypropyl 4-methylbenzenesulfonate (CAS: 16495-04-8)?

Answer

(2S)-3-(Benzyloxy)-2-hydroxypropyl 4-methylbenzenesulfonate
This compound is used in various industries, particularly in pharmaceuticals for drug synthesis, in polymer chemistry for the modification of polymers, and in semiconductor technology for surface treatment. It also finds applications in analytical chemistry as a reagent and in the production of sensors.

About

CAS No 16495-04-8
English Name (2S)-3-(Benzyloxy)-2-hydroxypropyl 4-methylbenzenesulfonate
Molecular Formula C17H20O5S
Molecular Weight 336.41 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)OCC(COCC2=CC=CC=C2)O
InChIKey HBMUWOSOGHUWSS-INIZCTEOSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-3-(Benzyloxy)-2-hydroxypropyl 4-methylbenzenesulfonate (CAS: 16495-04-8)?

The compound (2S)-3-(Benzyloxy)-2-hydroxypropyl 4-methylbenzenesulfonate has a crystalline form with...

Compound Q&A

How is (2S)-3-(Benzyloxy)-2-hydroxypropyl 4-methylbenzenesulfonate (CAS: 16495-04-8) typically synthesized?

This compound is typically synthesized through a multistep process involving the protection of a hyd...

Compound Q&A

What precautions should be taken when handling (2S)-3-(Benzyloxy)-2-hydroxypropyl 4-methylbenzenesulfonate (CAS: 16495-04-8)?

When handling (2S)-3-(Benzyloxy)-2-hydroxypropyl 4-methylbenzenesulfonate, it is important to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...