Compound Q&A

What precautions should be taken when handling 2-(2-Imino-2,3-dihydro-1,3-thiazol-4-yl)-N-(4-{2-[(2-phenylethyl)amino]ethyl}phenyl)acetamide (CAS: 1581284-82-3)?

Answer

2-(2-Imino-2,3-dihydro-1,3-thiazol-4-yl)-N-(4-{2-[(2-phenylethyl)amino]ethyl}phenyl)acetamide
When handling this compound, it is recommended to use personal protective equipment (PPE) such as gloves, goggles, and lab coats. It should be stored in a fume hood and away from heat sources. In case of spill, ensure proper ventilation and use appropriate absorbents to contain the spill. Always refer to the Safety Data Sheet (SDS) for detailed handling instructions.

About

English Name 2-(2-Imino-2,3-dihydro-1,3-thiazol-4-yl)-N-(4-{2-[(2-phenylethyl)amino]ethyl}phenyl)acetamide
Molecular Formula C21H24N4OS
Molecular Weight 380.52 g/mol
SMILES c1ccc(cc1)CCNCCc2ccc(cc2)NC(=O)Cc3csc(=N)[nH]3
InChIKey SRMFYHUWWFFNPI-UHFFFAOYSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2-Imino-2,3-dihydro-1,3-thiazol-4-yl)-N-(4-{2-[(2-phenylethyl)amino]ethyl}phenyl)acetamide (CAS: 1581284-82-3)?

This compound exists as a crystalline solid with a molecular weight of approximately 534.63 g/mol. I...

Compound Q&A

How is 2-(2-Imino-2,3-dihydro-1,3-thiazol-4-yl)-N-(4-{2-[(2-phenylethyl)amino]ethyl}phenyl)acetamide (CAS: 1581284-82-3) typically synthesized?

This compound can be synthesized via a multi-step process involving condensation reactions and alkyl...

Compound Q&A

What industries use 2-(2-Imino-2,3-dihydro-1,3-thiazol-4-yl)-N-(4-{2-[(2-phenylethyl)amino]ethyl}phenyl)acetamide (CAS: 1581284-82-3)?

This compound is primarily used in the pharmaceutical industry for its potential as an active pharma...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...