Compound Q&A

How is 2-(2-Imino-2,3-dihydro-1,3-thiazol-4-yl)-N-(4-{2-[(2-phenylethyl)amino]ethyl}phenyl)acetamide (CAS: 1581284-82-3) typically synthesized?

Answer

2-(2-Imino-2,3-dihydro-1,3-thiazol-4-yl)-N-(4-{2-[(2-phenylethyl)amino]ethyl}phenyl)acetamide
This compound can be synthesized via a multi-step process involving condensation reactions and alkylation. Commonly, it is prepared by reacting 4-aminophenylacetic acid with 2-(2-phenylethyl)ethanamine, followed by coupling with 2-imino-2,3-dihydro-1,3-thiazol-4-yl chloride using a suitable base under anhydrous conditions. Efficient yield and selectivity are typically achieved using appropriate solvents and catalysts.

About

English Name 2-(2-Imino-2,3-dihydro-1,3-thiazol-4-yl)-N-(4-{2-[(2-phenylethyl)amino]ethyl}phenyl)acetamide
Molecular Formula C21H24N4OS
Molecular Weight 380.52 g/mol
SMILES c1ccc(cc1)CCNCCc2ccc(cc2)NC(=O)Cc3csc(=N)[nH]3
InChIKey SRMFYHUWWFFNPI-UHFFFAOYSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2-Imino-2,3-dihydro-1,3-thiazol-4-yl)-N-(4-{2-[(2-phenylethyl)amino]ethyl}phenyl)acetamide (CAS: 1581284-82-3)?

This compound exists as a crystalline solid with a molecular weight of approximately 534.63 g/mol. I...

Compound Q&A

What industries use 2-(2-Imino-2,3-dihydro-1,3-thiazol-4-yl)-N-(4-{2-[(2-phenylethyl)amino]ethyl}phenyl)acetamide (CAS: 1581284-82-3)?

This compound is primarily used in the pharmaceutical industry for its potential as an active pharma...

Compound Q&A

What precautions should be taken when handling 2-(2-Imino-2,3-dihydro-1,3-thiazol-4-yl)-N-(4-{2-[(2-phenylethyl)amino]ethyl}phenyl)acetamide (CAS: 1581284-82-3)?

When handling this compound, it is recommended to use personal protective equipment (PPE) such as gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...