Compound Q&A

What industries use 2-(2-Imino-2,3-dihydro-1,3-thiazol-4-yl)-N-(4-{2-[(2-phenylethyl)amino]ethyl}phenyl)acetamide (CAS: 1581284-82-3)?

Answer

2-(2-Imino-2,3-dihydro-1,3-thiazol-4-yl)-N-(4-{2-[(2-phenylethyl)amino]ethyl}phenyl)acetamide
This compound is primarily used in the pharmaceutical industry for its potential as an active pharmaceutical ingredient (API) due to its biological activity. It may also have applications in the sensor industry for its detection capabilities, though more research is needed to fully explore its use in this field.

About

English Name 2-(2-Imino-2,3-dihydro-1,3-thiazol-4-yl)-N-(4-{2-[(2-phenylethyl)amino]ethyl}phenyl)acetamide
Molecular Formula C21H24N4OS
Molecular Weight 380.52 g/mol
SMILES c1ccc(cc1)CCNCCc2ccc(cc2)NC(=O)Cc3csc(=N)[nH]3
InChIKey SRMFYHUWWFFNPI-UHFFFAOYSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2-Imino-2,3-dihydro-1,3-thiazol-4-yl)-N-(4-{2-[(2-phenylethyl)amino]ethyl}phenyl)acetamide (CAS: 1581284-82-3)?

This compound exists as a crystalline solid with a molecular weight of approximately 534.63 g/mol. I...

Compound Q&A

How is 2-(2-Imino-2,3-dihydro-1,3-thiazol-4-yl)-N-(4-{2-[(2-phenylethyl)amino]ethyl}phenyl)acetamide (CAS: 1581284-82-3) typically synthesized?

This compound can be synthesized via a multi-step process involving condensation reactions and alkyl...

Compound Q&A

What precautions should be taken when handling 2-(2-Imino-2,3-dihydro-1,3-thiazol-4-yl)-N-(4-{2-[(2-phenylethyl)amino]ethyl}phenyl)acetamide (CAS: 1581284-82-3)?

When handling this compound, it is recommended to use personal protective equipment (PPE) such as gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...