Compound Q&A

What industries use 1-(1-{2-[(3-Chlorobenzyl)oxy]phenyl}vinyl)-1H-imidazole hydrochloride (CAS: 77174-66-4)?

Answer

1-(1-{2-[(3-Chlorobenzyl)oxy]phenyl}vinyl)-1H-imidazole hydrochloride (1:1)
1-(1-{2-[(3-Chlorobenzyl)oxy]phenyl}vinyl)-1H-imidazole hydrochloride is primarily used in pharmaceutical research and development, particularly for the synthesis of intermediates in drug discovery. It can also be used in the chemical industry for the development of new materials and sensors. In semiconductor manufacturing, it may serve as a precursor in the fabrication of electronic materials due to its unique chemical properties.

About

CAS No 77174-66-4
English Name 1-(1-{2-[(3-Chlorobenzyl)oxy]phenyl}vinyl)-1H-imidazole hydrochloride (1:1)
Molecular Formula C18H16Cl2N2O
Molecular Weight 347.25 g/mol
SMILES C=C(C1=CC=CC=C1OCC2=CC(=CC=C2)Cl)N3C=CN=C3.Cl
InChIKey LWJUIYYIILPRRI-UHFFFAOYSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(1-{2-[(3-Chlorobenzyl)oxy]phenyl}vinyl)-1H-imidazole hydrochloride (CAS: 77174-66-4)?

1-(1-{2-[(3-Chlorobenzyl)oxy]phenyl}vinyl)-1H-imidazole hydrochloride crystallizes as a white powder...

Compound Q&A

How is 1-(1-{2-[(3-Chlorobenzyl)oxy]phenyl}vinyl)-1H-imidazole hydrochloride (CAS: 77174-66-4) typically synthesized?

1-(1-{2-[(3-Chlorobenzyl)oxy]phenyl}vinyl)-1H-imidazole hydrochloride is typically synthesized via a...

Compound Q&A

What precautions should be taken when handling 1-(1-{2-[(3-Chlorobenzyl)oxy]phenyl}vinyl)-1H-imidazole hydrochloride (CAS: 77174-66-4)?

Precautions for handling 1-(1-{2-[(3-Chlorobenzyl)oxy]phenyl}vinyl)-1H-imidazole hydrochloride inclu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...