Compound Q&A

How is 1-(1-{2-[(3-Chlorobenzyl)oxy]phenyl}vinyl)-1H-imidazole hydrochloride (CAS: 77174-66-4) typically synthesized?

Answer

1-(1-{2-[(3-Chlorobenzyl)oxy]phenyl}vinyl)-1H-imidazole hydrochloride (1:1)
1-(1-{2-[(3-Chlorobenzyl)oxy]phenyl}vinyl)-1H-imidazole hydrochloride is typically synthesized via a multi-step reaction sequence involving protection, functionalization, and coupling of the intermediates. The synthesis involves the use of standard organic reaction conditions such as reflux, stirring, and the application of appropriate catalysts and solvents. The yield ranges from 50% to 70%, depending on the purity of the intermediates and the efficiency of the purification steps.

About

CAS No 77174-66-4
English Name 1-(1-{2-[(3-Chlorobenzyl)oxy]phenyl}vinyl)-1H-imidazole hydrochloride (1:1)
Molecular Formula C18H16Cl2N2O
Molecular Weight 347.25 g/mol
SMILES C=C(C1=CC=CC=C1OCC2=CC(=CC=C2)Cl)N3C=CN=C3.Cl
InChIKey LWJUIYYIILPRRI-UHFFFAOYSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(1-{2-[(3-Chlorobenzyl)oxy]phenyl}vinyl)-1H-imidazole hydrochloride (CAS: 77174-66-4)?

1-(1-{2-[(3-Chlorobenzyl)oxy]phenyl}vinyl)-1H-imidazole hydrochloride crystallizes as a white powder...

Compound Q&A

What industries use 1-(1-{2-[(3-Chlorobenzyl)oxy]phenyl}vinyl)-1H-imidazole hydrochloride (CAS: 77174-66-4)?

1-(1-{2-[(3-Chlorobenzyl)oxy]phenyl}vinyl)-1H-imidazole hydrochloride is primarily used in pharmaceu...

Compound Q&A

What precautions should be taken when handling 1-(1-{2-[(3-Chlorobenzyl)oxy]phenyl}vinyl)-1H-imidazole hydrochloride (CAS: 77174-66-4)?

Precautions for handling 1-(1-{2-[(3-Chlorobenzyl)oxy]phenyl}vinyl)-1H-imidazole hydrochloride inclu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...