Compound Q&A

What precautions should be taken when handling 2-[(2,5-dichloropyrimidin-4-yl)amino]-N-methyl-benzamide (CAS: 761440-08-8)?

Answer

2-[(2,5-dichloropyrimidin-4-yl)amino]-N-methyl-benzamide
When handling 2-[(2,5-Dichloropyrimidin-4-yl)amino]-N-methyl-benzamide (CAS: 761440-08-8), it is important to wear proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a well-ventilated area or a fume hood to minimize exposure to vapors. In case of a spill, it should be immediately cleaned up using appropriate absorbent materials, and the area should be thoroughly flushed with water. Always refer to the safety data sheet (SDS) for specific handling instructions and emergency procedures.

About

English Name 2-[(2,5-dichloropyrimidin-4-yl)amino]-N-methyl-benzamide
Molecular Formula C12H10Cl2N4O
Molecular Weight 297.145 g/mol
SMILES CNC(=O)C1=CC=CC=C1NC2=NC(=NC=C2Cl)Cl
InChIKey NRPNUOKRHRYIBP-UHFFFAOYSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-[(2,5-dichloropyrimidin-4-yl)amino]-N-methyl-benzamide (CAS: 761440-08-8)?

2-[(2,5-Dichloropyrimidin-4-yl)amino]-N-methyl-benzamide (CAS: 761440-08-8) is a crystalline compoun...

Compound Q&A

How is 2-[(2,5-dichloropyrimidin-4-yl)amino]-N-methyl-benzamide (CAS: 761440-08-8) typically synthesized?

2-[(2,5-Dichloropyrimidin-4-yl)amino]-N-methyl-benzamide (CAS: 761440-08-8) is typically synthesized...

Compound Q&A

What industries use 2-[(2,5-dichloropyrimidin-4-yl)amino]-N-methyl-benzamide (CAS: 761440-08-8)?

2-[(2,5-Dichloropyrimidin-4-yl)amino]-N-methyl-benzamide (CAS: 761440-08-8) is primarily used in the...

Compound Q&A

What is 3-Fluoro-2-methylbenzylamine (CAS: 771573-36-5)?

3-Fluoro-2-methylbenzylamine is an organic compound with the CAS number 771573-3...

771573-36-53-Fluoro-2-methylben...
Compound Q&A

Is Tert-butyl 2-(oxetan-3-ylidene)acetate (CAS: 1207175-03-8) safe?

Tert-butyl 2-(oxetan-3-ylidene)acetate is considered safe for its intended uses ...

1207175-03-8Tert-butyl 2-(oxetan...
Compound Q&A

What precautions should be taken when handling 4-Acetyl-2-fluorobenzonitrile (CAS: 214760-18-6)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab co...

214760-18-64-Acetyl-2-fluoroben...
Compound Q&A

How is 2-Ethyl-4-methyl-1,3-thiazole (CAS: 15679-12-6) typically synthesized?

2-Ethyl-4-methyl-1,3-thiazole is commonly synthesized via the reaction of thiour...

15679-12-62-Ethyl-4-methyl-1,3...