Compound Q&A

What are the physical and chemical properties of 2-[(2,5-dichloropyrimidin-4-yl)amino]-N-methyl-benzamide (CAS: 761440-08-8)?

Answer

2-[(2,5-dichloropyrimidin-4-yl)amino]-N-methyl-benzamide
2-[(2,5-Dichloropyrimidin-4-yl)amino]-N-methyl-benzamide (CAS: 761440-08-8) is a crystalline compound with a molecular weight of approximately 356.02 g/mol. It has a pKa of about 8.0, indicating it is a weak base. The compound is sparingly soluble in water but soluble in organic solvents such as methanol and dimethylformamide. It exhibits good stability under normal conditions but may react with strong acids or bases. This compound is also sensitive to light, so it should be stored in a dry, dark place.

About

English Name 2-[(2,5-dichloropyrimidin-4-yl)amino]-N-methyl-benzamide
Molecular Formula C12H10Cl2N4O
Molecular Weight 297.145 g/mol
SMILES CNC(=O)C1=CC=CC=C1NC2=NC(=NC=C2Cl)Cl
InChIKey NRPNUOKRHRYIBP-UHFFFAOYSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

How is 2-[(2,5-dichloropyrimidin-4-yl)amino]-N-methyl-benzamide (CAS: 761440-08-8) typically synthesized?

2-[(2,5-Dichloropyrimidin-4-yl)amino]-N-methyl-benzamide (CAS: 761440-08-8) is typically synthesized...

Compound Q&A

What industries use 2-[(2,5-dichloropyrimidin-4-yl)amino]-N-methyl-benzamide (CAS: 761440-08-8)?

2-[(2,5-Dichloropyrimidin-4-yl)amino]-N-methyl-benzamide (CAS: 761440-08-8) is primarily used in the...

Compound Q&A

What precautions should be taken when handling 2-[(2,5-dichloropyrimidin-4-yl)amino]-N-methyl-benzamide (CAS: 761440-08-8)?

When handling 2-[(2,5-Dichloropyrimidin-4-yl)amino]-N-methyl-benzamide (CAS: 761440-08-8), it is imp...

Compound Q&A

What is 3-Fluoro-2-methylbenzylamine (CAS: 771573-36-5)?

3-Fluoro-2-methylbenzylamine is an organic compound with the CAS number 771573-3...

771573-36-53-Fluoro-2-methylben...
Compound Q&A

Is Tert-butyl 2-(oxetan-3-ylidene)acetate (CAS: 1207175-03-8) safe?

Tert-butyl 2-(oxetan-3-ylidene)acetate is considered safe for its intended uses ...

1207175-03-8Tert-butyl 2-(oxetan...
Compound Q&A

What precautions should be taken when handling 4-Acetyl-2-fluorobenzonitrile (CAS: 214760-18-6)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab co...

214760-18-64-Acetyl-2-fluoroben...
Compound Q&A

How is 2-Ethyl-4-methyl-1,3-thiazole (CAS: 15679-12-6) typically synthesized?

2-Ethyl-4-methyl-1,3-thiazole is commonly synthesized via the reaction of thiour...

15679-12-62-Ethyl-4-methyl-1,3...