Compound Q&A

How is 2-[(2,5-dichloropyrimidin-4-yl)amino]-N-methyl-benzamide (CAS: 761440-08-8) typically synthesized?

Answer

2-[(2,5-dichloropyrimidin-4-yl)amino]-N-methyl-benzamide
2-[(2,5-Dichloropyrimidin-4-yl)amino]-N-methyl-benzamide (CAS: 761440-08-8) is typically synthesized via a multistep process involving the reaction of 2,5-dichloropyrimidine-4-amine with methylbenzoyl chloride in the presence of a suitable base such as triethylamine. The reaction yields the desired product with good selectivity and moderate to high yield, depending on the conditions.

About

English Name 2-[(2,5-dichloropyrimidin-4-yl)amino]-N-methyl-benzamide
Molecular Formula C12H10Cl2N4O
Molecular Weight 297.145 g/mol
SMILES CNC(=O)C1=CC=CC=C1NC2=NC(=NC=C2Cl)Cl
InChIKey NRPNUOKRHRYIBP-UHFFFAOYSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-[(2,5-dichloropyrimidin-4-yl)amino]-N-methyl-benzamide (CAS: 761440-08-8)?

2-[(2,5-Dichloropyrimidin-4-yl)amino]-N-methyl-benzamide (CAS: 761440-08-8) is a crystalline compoun...

Compound Q&A

What industries use 2-[(2,5-dichloropyrimidin-4-yl)amino]-N-methyl-benzamide (CAS: 761440-08-8)?

2-[(2,5-Dichloropyrimidin-4-yl)amino]-N-methyl-benzamide (CAS: 761440-08-8) is primarily used in the...

Compound Q&A

What precautions should be taken when handling 2-[(2,5-dichloropyrimidin-4-yl)amino]-N-methyl-benzamide (CAS: 761440-08-8)?

When handling 2-[(2,5-Dichloropyrimidin-4-yl)amino]-N-methyl-benzamide (CAS: 761440-08-8), it is imp...

Compound Q&A

What is 3-Fluoro-2-methylbenzylamine (CAS: 771573-36-5)?

3-Fluoro-2-methylbenzylamine is an organic compound with the CAS number 771573-3...

771573-36-53-Fluoro-2-methylben...
Compound Q&A

Is Tert-butyl 2-(oxetan-3-ylidene)acetate (CAS: 1207175-03-8) safe?

Tert-butyl 2-(oxetan-3-ylidene)acetate is considered safe for its intended uses ...

1207175-03-8Tert-butyl 2-(oxetan...
Compound Q&A

What precautions should be taken when handling 4-Acetyl-2-fluorobenzonitrile (CAS: 214760-18-6)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab co...

214760-18-64-Acetyl-2-fluoroben...
Compound Q&A

How is 2-Ethyl-4-methyl-1,3-thiazole (CAS: 15679-12-6) typically synthesized?

2-Ethyl-4-methyl-1,3-thiazole is commonly synthesized via the reaction of thiour...

15679-12-62-Ethyl-4-methyl-1,3...