Compound Q&A

What industries use 21-Hydroxyhenicosanoic acid (CAS: 89160-04-3)?

Answer

21-Hydroxyhenicosanoic acid
21-Hydroxyhenicosanoic acid (CAS: 89160-04-3) is primarily used in the pharmaceutical industry for the development of novel therapeutic agents. It also finds applications in the cosmetic industry as a skin conditioning agent and in the polymer industry for modifying the properties of polymer-based materials. Additionally, it is explored in analytical chemistry for applications such as chromatography and in the field of sensors for its unique physicochemical properties.

About

CAS No 89160-04-3
English Name 21-Hydroxyhenicosanoic acid
Molecular Formula C21H42O3
Molecular Weight 342.56 g/mol
SMILES C(CCCCCCCCCCO)CCCCCCCCCC(=O)O
InChIKey NENJNFMRWQAPAC-UHFFFAOYSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of 21-Hydroxyhenicosanoic acid (CAS: 89160-04-3)?

21-Hydroxyhenicosanoic acid (CAS: 89160-04-3) is a long-chain fatty acid with a molecular weight of ...

Compound Q&A

How is 21-Hydroxyhenicosanoic acid (CAS: 89160-04-3) typically synthesized?

21-Hydroxyhenicosanoic acid (CAS: 89160-04-3) can be synthesized through a series of steps, includin...

Compound Q&A

What precautions should be taken when handling 21-Hydroxyhenicosanoic acid (CAS: 89160-04-3)?

When handling 21-Hydroxyhenicosanoic acid (CAS: 89160-04-3), it is essential to use appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...