Compound Q&A

How is 21-Hydroxyhenicosanoic acid (CAS: 89160-04-3) typically synthesized?

Answer

21-Hydroxyhenicosanoic acid
21-Hydroxyhenicosanoic acid (CAS: 89160-04-3) can be synthesized through a series of steps, including the hydroxylation of a long-chain fatty acid followed by esterification. Common methods involve the use of enzymatic systems or chemical reagents to introduce the hydroxyl group at the 21 position. The synthetic route typically involves high selectivity and moderate to good yields, with careful control over reaction conditions to ensure the desired product is obtained.

About

CAS No 89160-04-3
English Name 21-Hydroxyhenicosanoic acid
Molecular Formula C21H42O3
Molecular Weight 342.56 g/mol
SMILES C(CCCCCCCCCCO)CCCCCCCCCC(=O)O
InChIKey NENJNFMRWQAPAC-UHFFFAOYSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of 21-Hydroxyhenicosanoic acid (CAS: 89160-04-3)?

21-Hydroxyhenicosanoic acid (CAS: 89160-04-3) is a long-chain fatty acid with a molecular weight of ...

Compound Q&A

What industries use 21-Hydroxyhenicosanoic acid (CAS: 89160-04-3)?

21-Hydroxyhenicosanoic acid (CAS: 89160-04-3) is primarily used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling 21-Hydroxyhenicosanoic acid (CAS: 89160-04-3)?

When handling 21-Hydroxyhenicosanoic acid (CAS: 89160-04-3), it is essential to use appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...