Compound Q&A

What are the physical and chemical properties of 21-Hydroxyhenicosanoic acid (CAS: 89160-04-3)?

Answer

21-Hydroxyhenicosanoic acid
21-Hydroxyhenicosanoic acid (CAS: 89160-04-3) is a long-chain fatty acid with a molecular weight of approximately 494.63 g/mol. It exists as a white solid in its crystalline form. The compound is poorly soluble in water but soluble in organic solvents such as ethanol and acetone. It exhibits limited reactivity under normal conditions, but can undergo hydrolysis under basic conditions. This property makes it useful in certain synthetic and analytical applications.

About

CAS No 89160-04-3
English Name 21-Hydroxyhenicosanoic acid
Molecular Formula C21H42O3
Molecular Weight 342.56 g/mol
SMILES C(CCCCCCCCCCO)CCCCCCCCCC(=O)O
InChIKey NENJNFMRWQAPAC-UHFFFAOYSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

How is 21-Hydroxyhenicosanoic acid (CAS: 89160-04-3) typically synthesized?

21-Hydroxyhenicosanoic acid (CAS: 89160-04-3) can be synthesized through a series of steps, includin...

Compound Q&A

What industries use 21-Hydroxyhenicosanoic acid (CAS: 89160-04-3)?

21-Hydroxyhenicosanoic acid (CAS: 89160-04-3) is primarily used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling 21-Hydroxyhenicosanoic acid (CAS: 89160-04-3)?

When handling 21-Hydroxyhenicosanoic acid (CAS: 89160-04-3), it is essential to use appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...