Compound Q&A

What precautions should be taken when handling Adrenomedullin (AM) (13-52), human (CAS: 154765-05-6)?

Answer

Adrenomedullin (AM) (13-52), human
When handling Adrenomedullin (AM) (13-52), human, ensure the use of personal protective equipment (PPE), including gloves, goggles, and lab coats. Work in a well-ventilated area, preferably with a fume hood. Store the compound at -20°C to -80°C to maintain stability. In case of a spill, use appropriate cleanup materials and follow laboratory safety protocols. Refer to the Safety Data Sheet (SDS) for detailed information and emergency procedures.

About

English Name Adrenomedullin (AM) (13-52), human
Molecular Formula C31H39FN6O2
Molecular Weight 546.68 g/mol
SMILES FC1=CC=CC(=C1CN1CC(CCC1C1CC1)NC(C1CCC2C(C(C3C=CC4=NC=CN4C=3)NN2)C1)=O)OC
InChIKey XJOVNCGUQXEANC-UHFFFAOYSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of Adrenomedullin (AM) (13-52), human (CAS: 154765-05-6)?

Adrenomedullin (AM) (13-52), human, is a 30-amino acid peptide with a molecular weight of approximat...

Compound Q&A

How is Adrenomedullin (AM) (13-52), human (CAS: 154765-05-6) typically synthesized?

Adrenomedullin (AM) (13-52), human, is typically synthesized via solid-phase peptide synthesis (SPPS...

Compound Q&A

What industries use Adrenomedullin (AM) (13-52), human (CAS: 154765-05-6)?

Adrenomedullin (AM) (13-52), human, is primarily used in the pharmaceutical industry for research on...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...