Compound Q&A

What industries use Desonide 21-acetate (CAS: 25092-25-5)?

Answer

Desonide 21-acetate
Desonide 21-acetate (CAS: 25092-25-5) is primarily used in pharmaceuticals, where it serves as a precursor in the synthesis of desonide, a corticosteroid used in topical dermatological treatments. It is also utilized in the polymer industry for its biological properties and in research applications due to its steroidal structure.

About

CAS No 25092-25-5
English Name Desonide 21-acetate
Molecular Formula C26H34O7
Molecular Weight 458.55 g/mol
SMILES CC(=O)OCC(=O)C12C(CC3C1(CC(C4C3CCC5=CC(=O)C=CC45C)O)C)OC(O2)(C)C
InChIKey IMVOEOHIGCNVQW-SBOGIFMKSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of Desonide 21-acetate (CAS: 25092-25-5)?

Desonide 21-acetate (CAS: 25092-25-5) is a crystalline compound with a molecular weight of approxima...

Compound Q&A

How is Desonide 21-acetate (CAS: 25092-25-5) typically synthesized?

Desonide 21-acetate (CAS: 25092-25-5) is typically synthesized by acetylation of desonide, a steroid...

Compound Q&A

What precautions should be taken when handling Desonide 21-acetate (CAS: 25092-25-5)?

When handling Desonide 21-acetate (CAS: 25092-25-5), it is important to use appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...