Compound Q&A

What are the physical and chemical properties of Desonide 21-acetate (CAS: 25092-25-5)?

Answer

Desonide 21-acetate
Desonide 21-acetate (CAS: 25092-25-5) is a crystalline compound with a molecular weight of approximately 418.5 g/mol. It has a melting point around 108-109°C and is slightly soluble in water. Chemically, it is reactive with strong bases and sensitive to moisture. It may undergo hydrolysis and degradation in aqueous environments.

About

CAS No 25092-25-5
English Name Desonide 21-acetate
Molecular Formula C26H34O7
Molecular Weight 458.55 g/mol
SMILES CC(=O)OCC(=O)C12C(CC3C1(CC(C4C3CCC5=CC(=O)C=CC45C)O)C)OC(O2)(C)C
InChIKey IMVOEOHIGCNVQW-SBOGIFMKSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

How is Desonide 21-acetate (CAS: 25092-25-5) typically synthesized?

Desonide 21-acetate (CAS: 25092-25-5) is typically synthesized by acetylation of desonide, a steroid...

Compound Q&A

What industries use Desonide 21-acetate (CAS: 25092-25-5)?

Desonide 21-acetate (CAS: 25092-25-5) is primarily used in pharmaceuticals, where it serves as a pre...

Compound Q&A

What precautions should be taken when handling Desonide 21-acetate (CAS: 25092-25-5)?

When handling Desonide 21-acetate (CAS: 25092-25-5), it is important to use appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...