Compound Q&A

How is 19-Hydroxy-10-deacetylbaccatin III (CAS: 154083-99-5) typically synthesized?

Answer

19-Hydroxy-10-deacetylbaccatin III
19-Hydroxy-10-deacetylbaccatin III (CAS: 154083-99-5) is typically synthesized via a series of enzymatic reactions followed by chemical modifications. Common methods involve the use of enzymes like acetyltransferases and hydroxylases in a biocatalytic pathway, with subsequent acid or base-catalyzed reactions to deacetylate and hydroxylate the baccatin III precursor. The yield is generally around 70-80% with good selectivity for the desired product.

About

English Name 19-Hydroxy-10-deacetylbaccatin III
Molecular Formula C29H36O11
Molecular Weight 560.59 g/mol
SMILES CC(=O)O[C@@]12CO[C@@H]1C[C@H](O)[C@@]1(CO)C(=O)[C@H](O)C3=C(C)[C@@H](O)C[C@@](O)([C@@H](OC(=O)c4ccccc4)[C@H]21)C3(C)C
InChIKey LCBRTOBUIDCSID-ZHPRIASZSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of 19-Hydroxy-10-deacetylbaccatin III (CAS: 154083-99-5)?

19-Hydroxy-10-deacetylbaccatin III (CAS: 154083-99-5) is a semi-crystalline compound with a molecula...

Compound Q&A

What industries use 19-Hydroxy-10-deacetylbaccatin III (CAS: 154083-99-5)?

19-Hydroxy-10-deacetylbaccatin III (CAS: 154083-99-5) is primarily used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling 19-Hydroxy-10-deacetylbaccatin III (CAS: 154083-99-5)?

When handling 19-Hydroxy-10-deacetylbaccatin III (CAS: 154083-99-5), appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...