Compound Q&A

What are the physical and chemical properties of 19-Hydroxy-10-deacetylbaccatin III (CAS: 154083-99-5)?

Answer

19-Hydroxy-10-deacetylbaccatin III
19-Hydroxy-10-deacetylbaccatin III (CAS: 154083-99-5) is a semi-crystalline compound with a molecular weight of approximately 470.4 g/mol. It has a low solubility in water but is soluble in organic solvents like methanol and ethanol. The compound is relatively stable under normal conditions but may undergo degradation upon exposure to light and moisture. It is used in synthetic pathways for taxol production and exhibits limited chemical reactivity under standard conditions.

About

English Name 19-Hydroxy-10-deacetylbaccatin III
Molecular Formula C29H36O11
Molecular Weight 560.59 g/mol
SMILES CC(=O)O[C@@]12CO[C@@H]1C[C@H](O)[C@@]1(CO)C(=O)[C@H](O)C3=C(C)[C@@H](O)C[C@@](O)([C@@H](OC(=O)c4ccccc4)[C@H]21)C3(C)C
InChIKey LCBRTOBUIDCSID-ZHPRIASZSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

How is 19-Hydroxy-10-deacetylbaccatin III (CAS: 154083-99-5) typically synthesized?

19-Hydroxy-10-deacetylbaccatin III (CAS: 154083-99-5) is typically synthesized via a series of enzym...

Compound Q&A

What industries use 19-Hydroxy-10-deacetylbaccatin III (CAS: 154083-99-5)?

19-Hydroxy-10-deacetylbaccatin III (CAS: 154083-99-5) is primarily used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling 19-Hydroxy-10-deacetylbaccatin III (CAS: 154083-99-5)?

When handling 19-Hydroxy-10-deacetylbaccatin III (CAS: 154083-99-5), appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...