Compound Q&A

What precautions should be taken when handling N-(2-Butyl-3-{4-[3-(dibutylamino)propoxy]benzoyl}-1-benzofuran-5-yl)-N-(methylsulfonyl)methanesulfonamide (CAS: 141626-57-5)?

Answer

N-(2-Butyl-3-{4-[3-(dibutylamino)propoxy]benzoyl}-1-benzofuran-5-yl)-N-(methylsulfonyl)methanesulfonamide
When handling this compound, it is crucial to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or fume hood to minimize exposure. Spills should be cleaned up immediately using appropriate absorbent materials, and the area should be thoroughly rinsed. Refer to the Safety Data Sheet (SDS) for detailed information on handling and disposal.

About

English Name N-(2-Butyl-3-{4-[3-(dibutylamino)propoxy]benzoyl}-1-benzofuran-5-yl)-N-(methylsulfonyl)methanesulfonamide
Molecular Formula C32H46N2O7S2
Molecular Weight 634.86 g/mol
SMILES CCCCc1c(c2cc(ccc2o1)N(S(=O)(=O)C)S(=O)(=O)C)C(=O)c3ccc(cc3)OCCCN(CCCC)CCCC
InChIKey IKGSSECULYFYER-UHFFFAOYSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-(2-Butyl-3-{4-[3-(dibutylamino)propoxy]benzoyl}-1-benzofuran-5-yl)-N-(methylsulfonyl)methanesulfonamide (CAS: 141626-57-5)?

N-(2-Butyl-3-{4-[3-(dibutylamino)propoxy]benzoyl}-1-benzofuran-5-yl)-N-(methylsulfonyl)methanesulfon...

Compound Q&A

How is N-(2-Butyl-3-{4-[3-(dibutylamino)propoxy]benzoyl}-1-benzofuran-5-yl)-N-(methylsulfonyl)methanesulfonamide (CAS: 141626-57-5) typically synthesized?

This compound can be synthesized through multistep reactions involving the coupling of 2-butyl-1-ben...

Compound Q&A

What industries use N-(2-Butyl-3-{4-[3-(dibutylamino)propoxy]benzoyl}-1-benzofuran-5-yl)-N-(methylsulfonyl)methanesulfonamide (CAS: 141626-57-5)?

This compound is primarily used in the pharmaceutical industry for its potential biological activiti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...