Compound Q&A

What are the physical and chemical properties of N-(2-Butyl-3-{4-[3-(dibutylamino)propoxy]benzoyl}-1-benzofuran-5-yl)-N-(methylsulfonyl)methanesulfonamide (CAS: 141626-57-5)?

Answer

N-(2-Butyl-3-{4-[3-(dibutylamino)propoxy]benzoyl}-1-benzofuran-5-yl)-N-(methylsulfonyl)methanesulfonamide
N-(2-Butyl-3-{4-[3-(dibutylamino)propoxy]benzoyl}-1-benzofuran-5-yl)-N-(methylsulfonyl)methanesulfonamide is a white crystalline solid with a molecular weight of approximately 786.8 g/mol. It has low solubility in water but is more soluble in organic solvents like DMF and DMSO. Reactivity is moderate with typical amide and sulfonamide functionalities. It is stable under normal conditions but should be stored in a cool, dry place away from light.

About

English Name N-(2-Butyl-3-{4-[3-(dibutylamino)propoxy]benzoyl}-1-benzofuran-5-yl)-N-(methylsulfonyl)methanesulfonamide
Molecular Formula C32H46N2O7S2
Molecular Weight 634.86 g/mol
SMILES CCCCc1c(c2cc(ccc2o1)N(S(=O)(=O)C)S(=O)(=O)C)C(=O)c3ccc(cc3)OCCCN(CCCC)CCCC
InChIKey IKGSSECULYFYER-UHFFFAOYSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

How is N-(2-Butyl-3-{4-[3-(dibutylamino)propoxy]benzoyl}-1-benzofuran-5-yl)-N-(methylsulfonyl)methanesulfonamide (CAS: 141626-57-5) typically synthesized?

This compound can be synthesized through multistep reactions involving the coupling of 2-butyl-1-ben...

Compound Q&A

What industries use N-(2-Butyl-3-{4-[3-(dibutylamino)propoxy]benzoyl}-1-benzofuran-5-yl)-N-(methylsulfonyl)methanesulfonamide (CAS: 141626-57-5)?

This compound is primarily used in the pharmaceutical industry for its potential biological activiti...

Compound Q&A

What precautions should be taken when handling N-(2-Butyl-3-{4-[3-(dibutylamino)propoxy]benzoyl}-1-benzofuran-5-yl)-N-(methylsulfonyl)methanesulfonamide (CAS: 141626-57-5)?

When handling this compound, it is crucial to wear appropriate personal protective equipment (PPE), ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...