Compound Q&A

What industries use (4aR,10bR)-4-Propyl-3,4,4a,5,6,10b-hexahydro-2H-naphtho[1,2-b][1,4]oxazin-9-ol hydrochloride (CAS: 99705-65-4)?

Answer

(4aR,10bR)-4-Propyl-3,4,4a,5,6,10b-hexahydro-2H-naphtho[1,2-b][1,4]oxazin-9-ol hydrochloride (1:1)
This compound is primarily used in the pharmaceutical industry for its potential as an intermediate in the synthesis of drugs. It also has applications in the polymer industry, where it can be used as a stabilizer or additive. Additionally, due to its unique chemical structure, it may be employed in the development of new sensor technologies and as a component in semiconductor manufacturing processes.

About

CAS No 99705-65-4
English Name (4aR,10bR)-4-Propyl-3,4,4a,5,6,10b-hexahydro-2H-naphtho[1,2-b][1,4]oxazin-9-ol hydrochloride (1:1)
Molecular Formula C15H22ClNO2
Molecular Weight 283.8 g/mol
SMILES CCCN1CCOC2C1CCC3=C2C=C(C=C3)O.Cl
InChIKey NNEACMQMRLNNIL-CTHHTMFSSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4aR,10bR)-4-Propyl-3,4,4a,5,6,10b-hexahydro-2H-naphtho[1,2-b][1,4]oxazin-9-ol hydrochloride (CAS: 99705-65-4)?

(4aR,10bR)-4-Propyl-3,4,4a,5,6,10b-hexahydro-2H-naphtho[1,2-b][1,4]oxazin-9-ol hydrochloride is a cr...

Compound Q&A

How is (4aR,10bR)-4-Propyl-3,4,4a,5,6,10b-hexahydro-2H-naphtho[1,2-b][1,4]oxazin-9-ol hydrochloride (CAS: 99705-65-4) typically synthesized?

The compound can be synthesized via a multi-step procedure, often involving the condensation of naph...

Compound Q&A

What precautions should be taken when handling (4aR,10bR)-4-Propyl-3,4,4a,5,6,10b-hexahydro-2H-naphtho[1,2-b][1,4]oxazin-9-ol hydrochloride (CAS: 99705-65-4)?

When handling (4aR,10bR)-4-Propyl-3,4,4a,5,6,10b-hexahydro-2H-naphtho[1,2-b][1,4]oxazin-9-ol hydroch...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...