Compound Q&A

How is (4aR,10bR)-4-Propyl-3,4,4a,5,6,10b-hexahydro-2H-naphtho[1,2-b][1,4]oxazin-9-ol hydrochloride (CAS: 99705-65-4) typically synthesized?

Answer

(4aR,10bR)-4-Propyl-3,4,4a,5,6,10b-hexahydro-2H-naphtho[1,2-b][1,4]oxazin-9-ol hydrochloride (1:1)
The compound can be synthesized via a multi-step procedure, often involving the condensation of naphthalene derivatives followed by ring expansion and oxidation. The exact synthesis route may vary depending on the availability of starting materials and desired purity, but common methods include the use of reagents like acetic anhydride and sodium hydroxide under controlled conditions. The yield and selectivity of the reaction can be optimized by adjusting reaction parameters such as temperature and time.

About

CAS No 99705-65-4
English Name (4aR,10bR)-4-Propyl-3,4,4a,5,6,10b-hexahydro-2H-naphtho[1,2-b][1,4]oxazin-9-ol hydrochloride (1:1)
Molecular Formula C15H22ClNO2
Molecular Weight 283.8 g/mol
SMILES CCCN1CCOC2C1CCC3=C2C=C(C=C3)O.Cl
InChIKey NNEACMQMRLNNIL-CTHHTMFSSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4aR,10bR)-4-Propyl-3,4,4a,5,6,10b-hexahydro-2H-naphtho[1,2-b][1,4]oxazin-9-ol hydrochloride (CAS: 99705-65-4)?

(4aR,10bR)-4-Propyl-3,4,4a,5,6,10b-hexahydro-2H-naphtho[1,2-b][1,4]oxazin-9-ol hydrochloride is a cr...

Compound Q&A

What industries use (4aR,10bR)-4-Propyl-3,4,4a,5,6,10b-hexahydro-2H-naphtho[1,2-b][1,4]oxazin-9-ol hydrochloride (CAS: 99705-65-4)?

This compound is primarily used in the pharmaceutical industry for its potential as an intermediate ...

Compound Q&A

What precautions should be taken when handling (4aR,10bR)-4-Propyl-3,4,4a,5,6,10b-hexahydro-2H-naphtho[1,2-b][1,4]oxazin-9-ol hydrochloride (CAS: 99705-65-4)?

When handling (4aR,10bR)-4-Propyl-3,4,4a,5,6,10b-hexahydro-2H-naphtho[1,2-b][1,4]oxazin-9-ol hydroch...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...