Compound Q&A

What industries use 2-Methyl-2-proanyl 2-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate (CAS: 1289387-44-5)?

Answer

2-Methyl-2-propanyl 2-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate
2-Methyl-2-proanyl 2-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate is primarily used in the pharmaceutical and fine chemical industries as a chiral building block. It serves as an intermediate in the synthesis of various chiral compounds, which are essential for drug development. Additionally, it finds applications in the production of chiral resolving agents and in the development of new chiral ligands for asymmetric catalysis.

About

English Name 2-Methyl-2-propanyl 2-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate
Molecular Formula C13H24N2O2
Molecular Weight 240.35 g/mol
SMILES CC(C)(C)OC(=O)N1CCCC1CNC2CC2
InChIKey SQRRQAVVRXZUMD-UHFFFAOYSA-N
Last Updated: 2026-03-07 19:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 2-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate (CAS: 1289387-44-5)?

2-Methyl-2-propanyl 2-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate is a white or off-white cr...

Compound Q&A

How is 2-Methyl-2-propanyl 2-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate (CAS: 1289387-44-5) typically synthesized?

2-Methyl-2-propanyl 2-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate is typically synthesized v...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 2-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate (CAS: 1289387-44-5)?

When handling 2-Methyl-2-proanyl 2-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate, it is import...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...