Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 2-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate (CAS: 1289387-44-5)?

Answer

2-Methyl-2-propanyl 2-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate
2-Methyl-2-propanyl 2-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate is a white or off-white crystalline solid with a molecular weight of approximately 288.4 g/mol. It has a pKa of around 6.5, indicating basicity. The compound is poorly soluble in water but soluble in organic solvents such as ethanol and acetone. It exhibits moderate reactivity in nucleophilic substitution reactions and can be used as a chiral building block in organic synthesis.

About

English Name 2-Methyl-2-propanyl 2-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate
Molecular Formula C13H24N2O2
Molecular Weight 240.35 g/mol
SMILES CC(C)(C)OC(=O)N1CCCC1CNC2CC2
InChIKey SQRRQAVVRXZUMD-UHFFFAOYSA-N
Last Updated: 2026-03-07 19:49

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 2-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate (CAS: 1289387-44-5) typically synthesized?

2-Methyl-2-propanyl 2-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate is typically synthesized v...

Compound Q&A

What industries use 2-Methyl-2-proanyl 2-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate (CAS: 1289387-44-5)?

2-Methyl-2-proanyl 2-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate is primarily used in the ph...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 2-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate (CAS: 1289387-44-5)?

When handling 2-Methyl-2-proanyl 2-[(cyclopropylamino)methyl]-1-pyrrolidinecarboxylate, it is import...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...