Compound Q&A

How is Biotin-PEG6-NHS ester (CAS: 2055045-04-8) typically synthesized?

Answer

Biotin-PEG6-NHS ester
Biotin-PEG6-NHS ester (CAS: 2055045-04-8) is synthesized by coupling biotin to a polyethylene glycol (PEG) chain using a NHS ester linker. The reaction involves the formation of an amide bond between the biotin amine group and the PEG-NHS ester. Commonly, this synthesis is performed in the presence of a catalytic amount of a coupling agent like DCC or EDC, with high selectivity and good yield.

About

English Name Biotin-PEG6-NHS ester
Molecular Formula C29H48N4O12S
Molecular Weight 676.79 g/mol
SMILES O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCOCCOCCNC(CCCC[C@@H]2SC[C@]([C@]2([H])N3)([H])NC3=O)=O
InChIKey QWDVPTVNWZPKBQ-LXWOLXCRSA-N
Last Updated: 2026-03-07 19:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Biotin-PEG6-NHS ester (CAS: 2055045-04-8)?

Biotin-PEG6-NHS ester (CAS: 2055045-04-8) is a polymer conjugate with a molecular weight of approxim...

Compound Q&A

What industries use Biotin-PEG6-NHS ester (CAS: 2055045-04-8)?

Biotin-PEG6-NHS ester (CAS: 2055045-04-8) is widely used in the pharmaceutical industry for drug del...

Compound Q&A

What precautions should be taken when handling Biotin-PEG6-NHS ester (CAS: 2055045-04-8)?

When handling Biotin-PEG6-NHS ester (CAS: 2055045-04-8), it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...