Compound Q&A

What are the physical and chemical properties of Biotin-PEG6-NHS ester (CAS: 2055045-04-8)?

Answer

Biotin-PEG6-NHS ester
Biotin-PEG6-NHS ester (CAS: 2055045-04-8) is a polymer conjugate with a molecular weight of approximately 1000 Da. It has a crystalline form and is poorly soluble in water but soluble in organic solvents. This compound is highly reactive towards amine groups, making it suitable for bioconjugation. It is used for linking biotin to proteins, polymers, and other molecules in various applications.

About

English Name Biotin-PEG6-NHS ester
Molecular Formula C29H48N4O12S
Molecular Weight 676.79 g/mol
SMILES O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCOCCOCCNC(CCCC[C@@H]2SC[C@]([C@]2([H])N3)([H])NC3=O)=O
InChIKey QWDVPTVNWZPKBQ-LXWOLXCRSA-N
Last Updated: 2026-03-07 19:49

Related Q&A

Compound Q&A

How is Biotin-PEG6-NHS ester (CAS: 2055045-04-8) typically synthesized?

Biotin-PEG6-NHS ester (CAS: 2055045-04-8) is synthesized by coupling biotin to a polyethylene glycol...

Compound Q&A

What industries use Biotin-PEG6-NHS ester (CAS: 2055045-04-8)?

Biotin-PEG6-NHS ester (CAS: 2055045-04-8) is widely used in the pharmaceutical industry for drug del...

Compound Q&A

What precautions should be taken when handling Biotin-PEG6-NHS ester (CAS: 2055045-04-8)?

When handling Biotin-PEG6-NHS ester (CAS: 2055045-04-8), it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...