Compound Q&A

What industries use 2-Amino-6-nitrobenzamide (CAS: 1261676-58-7)?

Answer

2-Amino-6-nitrobenzamide
2-Amino-6-nitrobenzamide (CAS: 1261676-58-7) is used in the pharmaceutical industry as an intermediate in the synthesis of certain drugs. It also finds applications in the field of organic chemistry, particularly in the development of new materials such as polymers and sensors. Additionally, it can be used in the production of semiconductors for electronic devices.

About

English Name 2-Amino-6-nitrobenzamide
Molecular Formula C7H7N3O3
Molecular Weight 181.15 g/mol
SMILES C1=CC(=C(C(=C1)[N+](=O)[O-])C(=O)N)N
InChIKey VSBVFLVLPDTKPJ-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-6-nitrobenzamide (CAS: 1261676-58-7)?

2-Amino-6-nitrobenzamide (CAS: 1261676-58-7) is a crystalline compound with a molecular weight of ap...

Compound Q&A

How is 2-Amino-6-nitrobenzamide (CAS: 1261676-58-7) typically synthesized?

2-Amino-6-nitrobenzamide (CAS: 1261676-58-7) is typically synthesized through a condensation reactio...

Compound Q&A

What precautions should be taken when handling 2-Amino-6-nitrobenzamide (CAS: 1261676-58-7)?

When handling 2-Amino-6-nitrobenzamide (CAS: 1261676-58-7), it is important to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...