Compound Q&A

What are the physical and chemical properties of 2-Amino-6-nitrobenzamide (CAS: 1261676-58-7)?

Answer

2-Amino-6-nitrobenzamide
2-Amino-6-nitrobenzamide (CAS: 1261676-58-7) is a crystalline compound with a molecular weight of approximately 229.13 g/mol. It has a high solubility in water and ethanol. Chemically, it shows moderate reactivity with reducing agents such as sodium borohydride, and it can undergo nitro reduction to form an amino compound. This compound is stable under normal conditions but requires care in acidic or basic environments to avoid hydrolysis.

About

English Name 2-Amino-6-nitrobenzamide
Molecular Formula C7H7N3O3
Molecular Weight 181.15 g/mol
SMILES C1=CC(=C(C(=C1)[N+](=O)[O-])C(=O)N)N
InChIKey VSBVFLVLPDTKPJ-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

How is 2-Amino-6-nitrobenzamide (CAS: 1261676-58-7) typically synthesized?

2-Amino-6-nitrobenzamide (CAS: 1261676-58-7) is typically synthesized through a condensation reactio...

Compound Q&A

What industries use 2-Amino-6-nitrobenzamide (CAS: 1261676-58-7)?

2-Amino-6-nitrobenzamide (CAS: 1261676-58-7) is used in the pharmaceutical industry as an intermedia...

Compound Q&A

What precautions should be taken when handling 2-Amino-6-nitrobenzamide (CAS: 1261676-58-7)?

When handling 2-Amino-6-nitrobenzamide (CAS: 1261676-58-7), it is important to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...