Compound Q&A

How is 2-Amino-6-nitrobenzamide (CAS: 1261676-58-7) typically synthesized?

Answer

2-Amino-6-nitrobenzamide
2-Amino-6-nitrobenzamide (CAS: 1261676-58-7) is typically synthesized through a condensation reaction between 6-nitrobenzoic acid and ammonia or an amine derivative under mild conditions. The reaction can be catalyzed by acetic acid or other suitable solvents. The yield is generally around 70-80%, and the product is usually isolated by recrystallization from solvents such as ethanol or water.

About

English Name 2-Amino-6-nitrobenzamide
Molecular Formula C7H7N3O3
Molecular Weight 181.15 g/mol
SMILES C1=CC(=C(C(=C1)[N+](=O)[O-])C(=O)N)N
InChIKey VSBVFLVLPDTKPJ-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-6-nitrobenzamide (CAS: 1261676-58-7)?

2-Amino-6-nitrobenzamide (CAS: 1261676-58-7) is a crystalline compound with a molecular weight of ap...

Compound Q&A

What industries use 2-Amino-6-nitrobenzamide (CAS: 1261676-58-7)?

2-Amino-6-nitrobenzamide (CAS: 1261676-58-7) is used in the pharmaceutical industry as an intermedia...

Compound Q&A

What precautions should be taken when handling 2-Amino-6-nitrobenzamide (CAS: 1261676-58-7)?

When handling 2-Amino-6-nitrobenzamide (CAS: 1261676-58-7), it is important to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...