Compound Q&A

What industries use Sertindole-d (CAS: 1794737-42-0)?

Answer

Sertindole-d
Sertindole-d is primarily used in the pharmaceutical industry for the treatment of schizophrenia. It is also used in research and development for its potential in treating various neurological disorders. Due to its chemical structure, it may find applications in the development of new drugs and as a precursor for other chemical compounds.

About

English Name Sertindole-d
Molecular Formula C24H22D4ClFN4O
Molecular Weight 444.97 g/mol
SMILES Clc1ccc2c(c1)c(cn2c1ccc(cc1)F)C1CCN(CC1)C(C(N1CCNC1=O)([2H])[2H])([2H])[2H]
InChIKey GZKLJWGUPQBVJQ-RYIWKTDQSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sertindole-d (CAS: 1794737-42-0)?

Sertindole-d is a white to off-white crystalline powder. Its molecular weight is approximately 434.4...

Compound Q&A

How is Sertindole-d (CAS: 1794737-42-0) typically synthesized?

Sertindole-d is typically synthesized through a multi-step process involving the coupling of 2,4-dic...

Compound Q&A

What precautions should be taken when handling Sertindole-d (CAS: 1794737-42-0)?

When handling Sertindole-d, it is important to wear appropriate personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...