Compound Q&A

How is Sertindole-d (CAS: 1794737-42-0) typically synthesized?

Answer

Sertindole-d
Sertindole-d is typically synthesized through a multi-step process involving the coupling of 2,4-dichloroaniline with 4-aminobenzaldehyde. The reaction is catalyzed by palladium(II) acetate and is conducted under mild conditions. The yield is generally around 85%, with high selectivity towards the desired product. The process involves careful control of temperature and reaction time to achieve the desired purity and yield.

About

English Name Sertindole-d
Molecular Formula C24H22D4ClFN4O
Molecular Weight 444.97 g/mol
SMILES Clc1ccc2c(c1)c(cn2c1ccc(cc1)F)C1CCN(CC1)C(C(N1CCNC1=O)([2H])[2H])([2H])[2H]
InChIKey GZKLJWGUPQBVJQ-RYIWKTDQSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sertindole-d (CAS: 1794737-42-0)?

Sertindole-d is a white to off-white crystalline powder. Its molecular weight is approximately 434.4...

Compound Q&A

What industries use Sertindole-d (CAS: 1794737-42-0)?

Sertindole-d is primarily used in the pharmaceutical industry for the treatment of schizophrenia. It...

Compound Q&A

What precautions should be taken when handling Sertindole-d (CAS: 1794737-42-0)?

When handling Sertindole-d, it is important to wear appropriate personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...