Compound Q&A

What industries use 4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate (CAS: 80008-69-1)?

Answer

4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate
4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate is used in the pharmaceutical industry for the development of new drugs, as a precursor in organic synthesis, and in the sensor industry for the fabrication of gas sensors. It is also utilized in the semiconductor industry for the manufacturing of advanced materials.

About

CAS No 80008-69-1
English Name 4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate
Molecular Formula C15H16BrN2O4P
Molecular Weight 399.18 g/mol
EINECS 1533716-785-6
SMILES Cc1ccc(cc1)[NH3+].c1cc2c(cc1Br)c(c[nH]2)OP(=O)(O)[O-]
InChIKey MTKYSMVJOACNBO-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate (CAS: 80008-69-1)?

4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate is a crystalline compound with a molecula...

Compound Q&A

How is 4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate (CAS: 80008-69-1) typically synthesized?

4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate is typically synthesized through a multis...

Compound Q&A

What precautions should be taken when handling 4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate (CAS: 80008-69-1)?

When handling 4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate, appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...