Compound Q&A

What are the physical and chemical properties of 4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate (CAS: 80008-69-1)?

Answer

4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate
4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate is a crystalline compound with a molecular weight of approximately 380.07 g/mol. It has a low solubility in water but is more soluble in organic solvents. This compound is moderately reactive and can undergo substitution reactions. It is stable under normal conditions but may react with strong bases and oxidizing agents.

About

CAS No 80008-69-1
English Name 4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate
Molecular Formula C15H16BrN2O4P
Molecular Weight 399.18 g/mol
EINECS 1533716-785-6
SMILES Cc1ccc(cc1)[NH3+].c1cc2c(cc1Br)c(c[nH]2)OP(=O)(O)[O-]
InChIKey MTKYSMVJOACNBO-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

How is 4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate (CAS: 80008-69-1) typically synthesized?

4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate is typically synthesized through a multis...

Compound Q&A

What industries use 4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate (CAS: 80008-69-1)?

4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate is used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling 4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate (CAS: 80008-69-1)?

When handling 4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate, appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...