Compound Q&A

How is 4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate (CAS: 80008-69-1) typically synthesized?

Answer

4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate
4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate is typically synthesized through a multistep process involving the bromination of indole and subsequent coupling with 4-methylaniline. The reaction is catalyzed by a Lewis acid such as aluminum chloride, and the yield is around 70-80%. The product is isolated by recrystallization from an appropriate solvent.

About

CAS No 80008-69-1
English Name 4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate
Molecular Formula C15H16BrN2O4P
Molecular Weight 399.18 g/mol
EINECS 1533716-785-6
SMILES Cc1ccc(cc1)[NH3+].c1cc2c(cc1Br)c(c[nH]2)OP(=O)(O)[O-]
InChIKey MTKYSMVJOACNBO-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate (CAS: 80008-69-1)?

4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate is a crystalline compound with a molecula...

Compound Q&A

What industries use 4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate (CAS: 80008-69-1)?

4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate is used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling 4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate (CAS: 80008-69-1)?

When handling 4-Methylanilinium 5-bromo-1H-indol-3-yl hydrogen phosphate, appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...