Compound Q&A

What industries use (8beta)-N,N,6-Triethyl-9,10-didehydroergoline-8-carboxamide (CAS: 65527-62-0)?

Answer

(8beta)-N,N,6-Triethyl-9,10-didehydroergoline-8-carboxamide
(8beta)-N,N,6-Triethyl-9,10-didehydroergoline-8-carboxamide is primarily used in the pharmaceutical industry for the development of novel bioactive compounds. It may also find applications in the production of polymers and sensors due to its chemical structure and reactivity. Additionally, it could be explored for its potential use in semiconductors as it may exhibit specific electronic properties.

About

CAS No 65527-62-0
English Name (8beta)-N,N,6-Triethyl-9,10-didehydroergoline-8-carboxamide
Molecular Formula C21H27N3O
Molecular Weight 337.47 g/mol
SMILES CCN1C[C@@H](C=C2[C@H]1Cc3c[nH]c4c3c2ccc4)C(=O)N(CC)CC
InChIKey MYNOUXJLOHVSMQ-DNVCBOLYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

What are the physical and chemical properties of (8beta)-N,N,6-Triethyl-9,10-didehydroergoline-8-carboxamide (CAS: 65527-62-0)?

(8beta)-N,N,6-Triethyl-9,10-didehydroergoline-8-carboxamide is a white crystalline solid with a mole...

Compound Q&A

How is (8beta)-N,N,6-Triethyl-9,10-didehydroergoline-8-carboxamide (CAS: 65527-62-0) typically synthesized?

(8beta)-N,N,6-Triethyl-9,10-didehydroergoline-8-carboxamide can be synthesized by modifying ergoline...

Compound Q&A

What precautions should be taken when handling (8beta)-N,N,6-Triethyl-9,10-didehydroergoline-8-carboxamide (CAS: 65527-62-0)?

When handling (8beta)-N,N,6-Triethyl-9,10-didehydroergoline-8-carboxamide, it is crucial to work in ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...