Compound Q&A

What precautions should be taken when handling (3S,4S,5S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-hydroxy-5-methylheptanoic acid (CAS: 215190-17-3)?

Answer

(3S,4S,5S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-hydroxy-5-methylheptanoic acid
Proper personal protective equipment (PPE) such as gloves, goggles, and lab coats should be worn. It should be handled in a well-ventilated area or a fume hood. Spills should be cleaned up using appropriate absorbent materials. Always refer to the safety data sheet (SDS) for detailed handling and disposal information.

About

English Name (3S,4S,5S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-hydroxy-5-methylheptanoic acid
Molecular Formula C23H27NO5
Molecular Weight 397.47 g/mol
SMILES CCC(C)C(C(CC(=O)O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
InChIKey QTHRPXQGSVSFOG-FSJXIACGSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S,4S,5S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-hydroxy-5-methylheptanoic acid (CAS: 215190-17-3)?

The compound has a crystalline form and a molecular weight of approximately 424.45 g/mol. It is slig...

Compound Q&A

How is (3S,4S,5S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-hydroxy-5-methylheptanoic acid (CAS: 215190-17-3) typically synthesized?

This compound is typically synthesized through multistep organic reactions involving carboxylation, ...

Compound Q&A

What industries use (3S,4S,5S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-hydroxy-5-methylheptanoic acid (CAS: 215190-17-3)?

This compound is primarily used in the pharmaceutical industry for medicinal chemistry and drug disc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...