Compound Q&A

What industries use (3S,4S,5S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-hydroxy-5-methylheptanoic acid (CAS: 215190-17-3)?

Answer

(3S,4S,5S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-hydroxy-5-methylheptanoic acid
This compound is primarily used in the pharmaceutical industry for medicinal chemistry and drug discovery. It is also used in the preparation of other chemical intermediates and in the development of new materials. Its properties make it suitable for applications in polymers and sensors.

About

English Name (3S,4S,5S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-hydroxy-5-methylheptanoic acid
Molecular Formula C23H27NO5
Molecular Weight 397.47 g/mol
SMILES CCC(C)C(C(CC(=O)O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
InChIKey QTHRPXQGSVSFOG-FSJXIACGSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S,4S,5S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-hydroxy-5-methylheptanoic acid (CAS: 215190-17-3)?

The compound has a crystalline form and a molecular weight of approximately 424.45 g/mol. It is slig...

Compound Q&A

How is (3S,4S,5S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-hydroxy-5-methylheptanoic acid (CAS: 215190-17-3) typically synthesized?

This compound is typically synthesized through multistep organic reactions involving carboxylation, ...

Compound Q&A

What precautions should be taken when handling (3S,4S,5S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-hydroxy-5-methylheptanoic acid (CAS: 215190-17-3)?

Proper personal protective equipment (PPE) such as gloves, goggles, and lab coats should be worn. It...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...