Compound Q&A

How is (3S,4S,5S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-hydroxy-5-methylheptanoic acid (CAS: 215190-17-3) typically synthesized?

Answer

(3S,4S,5S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-hydroxy-5-methylheptanoic acid
This compound is typically synthesized through multistep organic reactions involving carboxylation, acylation, and coupling reactions. Commonly, it is synthesized using fluorenylmethoxycarbonyl (Fmoc) protection, which provides good selectivity and yield. Specific details of synthetic methods can be found in the literature.

About

English Name (3S,4S,5S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-hydroxy-5-methylheptanoic acid
Molecular Formula C23H27NO5
Molecular Weight 397.47 g/mol
SMILES CCC(C)C(C(CC(=O)O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
InChIKey QTHRPXQGSVSFOG-FSJXIACGSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S,4S,5S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-hydroxy-5-methylheptanoic acid (CAS: 215190-17-3)?

The compound has a crystalline form and a molecular weight of approximately 424.45 g/mol. It is slig...

Compound Q&A

What industries use (3S,4S,5S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-hydroxy-5-methylheptanoic acid (CAS: 215190-17-3)?

This compound is primarily used in the pharmaceutical industry for medicinal chemistry and drug disc...

Compound Q&A

What precautions should be taken when handling (3S,4S,5S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-hydroxy-5-methylheptanoic acid (CAS: 215190-17-3)?

Proper personal protective equipment (PPE) such as gloves, goggles, and lab coats should be worn. It...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...