Compound Q&A

What precautions should be taken when handling methyl 4-bromo-6-(tert-butoxycarbonylamino)pyridine-2-carboxylate (CAS: 885326-87-4)?

Answer

methyl 4-bromo-6-(tert-butoxycarbonylamino)pyridine-2-carboxylate
When handling methyl 4-bromo-6-(tert-butoxycarbonylamino)pyridine-2-carboxylate (CAS: 885326-87-4), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and lab coat. Work in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up immediately using suitable absorbent materials. Refer to the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

English Name methyl 4-bromo-6-(tert-butoxycarbonylamino)pyridine-2-carboxylate
Molecular Formula C12H15BrN2O4
Molecular Weight 331.17 g/mol
SMILES CC(C)(C)OC(=O)NC1=CC(=CC(=N1)C(=O)OC)Br
InChIKey AKTYIVKMAJBROD-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

What are the physical and chemical properties of methyl 4-bromo-6-(tert-butoxycarbonylamino)pyridine-2-carboxylate (CAS: 885326-87-4)?

Methyl 4-bromo-6-(tert-butoxycarbonylamino)pyridine-2-carboxylate (CAS: 885326-87-4) is a crystallin...

Compound Q&A

How is methyl 4-bromo-6-(tert-butoxycarbonylamino)pyridine-2-carboxylate (CAS: 885326-87-4) typically synthesized?

Methyl 4-bromo-6-(tert-butoxycarbonylamino)pyridine-2-carboxylate (CAS: 885326-87-4) is synthesized ...

Compound Q&A

What industries use methyl 4-bromo-6-(tert-butoxycarbonylamino)pyridine-2-carboxylate (CAS: 885326-87-4)?

Methyl 4-bromo-6-(tert-butoxycarbonylamino)pyridine-2-carboxylate (CAS: 885326-87-4) is primarily us...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...