Compound Q&A

What are the physical and chemical properties of methyl 4-bromo-6-(tert-butoxycarbonylamino)pyridine-2-carboxylate (CAS: 885326-87-4)?

Answer

methyl 4-bromo-6-(tert-butoxycarbonylamino)pyridine-2-carboxylate
Methyl 4-bromo-6-(tert-butoxycarbonylamino)pyridine-2-carboxylate (CAS: 885326-87-4) is a crystalline compound with a molecular weight of approximately 386.11 g/mol. It has a low solubility in water but good solubility in organic solvents like methanol and acetone. This compound is generally stable under normal conditions but can be reactive towards strong bases. It is an important intermediate in organic synthesis, particularly in medicinal chemistry.

About

English Name methyl 4-bromo-6-(tert-butoxycarbonylamino)pyridine-2-carboxylate
Molecular Formula C12H15BrN2O4
Molecular Weight 331.17 g/mol
SMILES CC(C)(C)OC(=O)NC1=CC(=CC(=N1)C(=O)OC)Br
InChIKey AKTYIVKMAJBROD-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

How is methyl 4-bromo-6-(tert-butoxycarbonylamino)pyridine-2-carboxylate (CAS: 885326-87-4) typically synthesized?

Methyl 4-bromo-6-(tert-butoxycarbonylamino)pyridine-2-carboxylate (CAS: 885326-87-4) is synthesized ...

Compound Q&A

What industries use methyl 4-bromo-6-(tert-butoxycarbonylamino)pyridine-2-carboxylate (CAS: 885326-87-4)?

Methyl 4-bromo-6-(tert-butoxycarbonylamino)pyridine-2-carboxylate (CAS: 885326-87-4) is primarily us...

Compound Q&A

What precautions should be taken when handling methyl 4-bromo-6-(tert-butoxycarbonylamino)pyridine-2-carboxylate (CAS: 885326-87-4)?

When handling methyl 4-bromo-6-(tert-butoxycarbonylamino)pyridine-2-carboxylate (CAS: 885326-87-4), ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...