Compound Q&A

What industries use 3-Benzoyl-2-pyridinecarboxylic acid (CAS: 64362-32-9)?

Answer

3-Benzoyl-2-pyridinecarboxylic acid
3-Benzoyl-2-pyridinecarboxylic acid is used in various industries, including pharmaceuticals, where it serves as an intermediate in the synthesis of certain drugs. It is also relevant in the manufacturing of polymers, sensors, and semiconductors due to its chemical reactivity and structural properties.

About

CAS No 64362-32-9
English Name 3-Benzoyl-2-pyridinecarboxylic acid
Molecular Formula C13H9NO3
Molecular Weight 227.22 g/mol
SMILES C1=CC=C(C=C1)C(=O)C2=C(N=CC=C2)C(=O)O
InChIKey YERHKEWRHQIXFY-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Benzoyl-2-pyridinecarboxylic acid (CAS: 64362-32-9)?

3-Benzoyl-2-pyridinecarboxylic acid is a crystalline solid with a molecular weight of approximately ...

Compound Q&A

How is 3-Benzoyl-2-pyridinecarboxylic acid (CAS: 64362-32-9) typically synthesized?

3-Benzoyl-2-pyridinecarboxylic acid can be synthesized through the condensation of 2-pyridinecarboxy...

Compound Q&A

What precautions should be taken when handling 3-Benzoyl-2-pyridinecarboxylic acid (CAS: 64362-32-9)?

When handling 3-Benzoyl-2-pyridinecarboxylic acid (CAS: 64362-32-9), it is crucial to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...