Compound Q&A

How is 3-Benzoyl-2-pyridinecarboxylic acid (CAS: 64362-32-9) typically synthesized?

Answer

3-Benzoyl-2-pyridinecarboxylic acid
3-Benzoyl-2-pyridinecarboxylic acid can be synthesized through the condensation of 2-pyridinecarboxylic acid and benzoic anhydride in the presence of a Lewis acid catalyst like aluminum trichloride. The reaction is exothermic and yields a high purity product with good selectivity and moderate to high yield.

About

CAS No 64362-32-9
English Name 3-Benzoyl-2-pyridinecarboxylic acid
Molecular Formula C13H9NO3
Molecular Weight 227.22 g/mol
SMILES C1=CC=C(C=C1)C(=O)C2=C(N=CC=C2)C(=O)O
InChIKey YERHKEWRHQIXFY-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Benzoyl-2-pyridinecarboxylic acid (CAS: 64362-32-9)?

3-Benzoyl-2-pyridinecarboxylic acid is a crystalline solid with a molecular weight of approximately ...

Compound Q&A

What industries use 3-Benzoyl-2-pyridinecarboxylic acid (CAS: 64362-32-9)?

3-Benzoyl-2-pyridinecarboxylic acid is used in various industries, including pharmaceuticals, where ...

Compound Q&A

What precautions should be taken when handling 3-Benzoyl-2-pyridinecarboxylic acid (CAS: 64362-32-9)?

When handling 3-Benzoyl-2-pyridinecarboxylic acid (CAS: 64362-32-9), it is crucial to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...